C29H39BrO3 — CID 140692574
1-[(3S,10R,13S,17S)-3-[(4-bromophenyl)methoxy]-3-hydroxy-10,13,17-trimethyl-2,4,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-yl]ethanone (PubChem CID 140692574) has the molecular formula C29H39BrO3 and a molecular weight of 515.53 g/mol. Its IUPAC name is 1-[(3S,10R,13S,17S)-3-[(4-bromophenyl)methoxy]-3-hydroxy-10,13,17-trimethyl-2,4,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-yl]ethanone.
| Compound Name | 1-[(3S,10R,13S,17S)-3-[(4-bromophenyl)methoxy]-3-hydroxy-10,13,17-trimethyl-2,4,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-yl]ethanone |
|---|---|
| PubChem CID | 140692574 |
| Molecular Formula | C29H39BrO3 |
| Molecular Weight | 515.53 g/mol |
| Exact Mass | 514.21 |
| IUPAC Name | 1-[(3S,10R,13S,17S)-3-[(4-bromophenyl)methoxy]-3-hydroxy-10,13,17-trimethyl-2,4,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-yl]ethanone |
| SMILES | CC(=O)[C@@]1(C)CCC2C3CC=C4C[C@@](O)(OCc5ccc(Br)cc5)CC[C@]4(C)C3CC[C@@]21C |
| InChI | InChI=1S/C29H39BrO3/c1-19(31)27(3)13-12-25-23-10-7-21-17-29(32,33-18-20-5-8-22(30)9-6-20)16-15-26(21,2)24(23)11-14-28(25,27)4/h5-9,23-25,32H,10-18H2,1-4H3/t23?,24?,25?,26-,27+,28-,29-/m0/s1 |
| InChIKey | GHQFGHTVJJQTAW-QZTQVZCKSA-N |
| XLogP | 7.21 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.53 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|