C30H41FO4 — CID 118417087
1-[(8R,9S,10R,13S,14S,17R)-17-ethoxy-3-[(4-fluorophenyl)methoxy]-3-hydroxy-10,13-dimethyl-2,4,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-yl]ethanone (PubChem CID 118417087) has the molecular formula C30H41FO4 and a molecular weight of 484.65 g/mol. Its IUPAC name is 1-[(8R,9S,10R,13S,14S,17R)-17-ethoxy-3-[(4-fluorophenyl)methoxy]-3-hydroxy-10,13-dimethyl-2,4,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-yl]ethanone.
| Compound Name | 1-[(8R,9S,10R,13S,14S,17R)-17-ethoxy-3-[(4-fluorophenyl)methoxy]-3-hydroxy-10,13-dimethyl-2,4,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-yl]ethanone |
|---|---|
| PubChem CID | 118417087 |
| Molecular Formula | C30H41FO4 |
| Molecular Weight | 484.65 g/mol |
| Exact Mass | 484.30 |
| IUPAC Name | 1-[(8R,9S,10R,13S,14S,17R)-17-ethoxy-3-[(4-fluorophenyl)methoxy]-3-hydroxy-10,13-dimethyl-2,4,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-yl]ethanone |
| SMILES | CCO[C@]1(C(C)=O)CC[C@H]2[C@@H]3CC=C4CC(O)(OCc5ccc(F)cc5)CC[C@]4(C)[C@H]3CC[C@@]21C |
| InChI | InChI=1S/C30H41FO4/c1-5-34-30(20(2)32)15-13-26-24-11-8-22-18-29(33,35-19-21-6-9-23(31)10-7-21)17-16-27(22,3)25(24)12-14-28(26,30)4/h6-10,24-26,33H,5,11-19H2,1-4H3/t24-,25+,26+,27+,28+,29?,30+/m1/s1 |
| InChIKey | MQVVRMBMUPKYAS-CIPNRDRLSA-N |
| XLogP | 6.36 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.65 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|