C32H44O6 — CID 90189217
2-[[(8R,9S,10R,13S,14S,17R)-17-acetyl-17-ethoxy-3-hydroxy-10,13-dimethyl-2,4,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]-2-(4-methylphenyl)acetic acid (PubChem CID 90189217) has the molecular formula C32H44O6 and a molecular weight of 524.70 g/mol. Its IUPAC name is 2-[[(8R,9S,10R,13S,14S,17R)-17-acetyl-17-ethoxy-3-hydroxy-10,13-dimethyl-2,4,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]-2-(4-methylphenyl)acetic acid.
| Compound Name | 2-[[(8R,9S,10R,13S,14S,17R)-17-acetyl-17-ethoxy-3-hydroxy-10,13-dimethyl-2,4,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]-2-(4-methylphenyl)acetic acid |
|---|---|
| PubChem CID | 90189217 |
| Molecular Formula | C32H44O6 |
| Molecular Weight | 524.70 g/mol |
| Exact Mass | 524.31 |
| IUPAC Name | 2-[[(8R,9S,10R,13S,14S,17R)-17-acetyl-17-ethoxy-3-hydroxy-10,13-dimethyl-2,4,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]-2-(4-methylphenyl)acetic acid |
| SMILES | CCO[C@]1(C(C)=O)CC[C@H]2[C@@H]3CC=C4CC(O)(OC(C(=O)O)c5ccc(C)cc5)CC[C@]4(C)[C@H]3CC[C@@]21C |
| InChI | InChI=1S/C32H44O6/c1-6-37-32(21(3)33)16-14-26-24-12-11-23-19-31(36,18-17-29(23,4)25(24)13-15-30(26,32)5)38-27(28(34)35)22-9-7-20(2)8-10-22/h7-11,24-27,36H,6,12-19H2,1-5H3,(H,34,35)/t24-,25+,26+,27?,29+,30+,31?,32+/m1/s1 |
| InChIKey | RTYKATGGNLAECU-PDGVSXBJSA-N |
| XLogP | 6.15 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.70 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|