C25H36O5 — CID 117066290
[(17'S)-17'-acetyl-10',13'-dimethylspiro[1,3-dioxolane-2,3'-2,4,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene]-17'-yl] acetate (PubChem CID 117066290) has the molecular formula C25H36O5 and a molecular weight of 416.56 g/mol. Its IUPAC name is [(17'S)-17'-acetyl-10',13'-dimethylspiro[1,3-dioxolane-2,3'-2,4,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene]-17'-yl] acetate.
| Compound Name | [(17'S)-17'-acetyl-10',13'-dimethylspiro[1,3-dioxolane-2,3'-2,4,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene]-17'-yl] acetate |
|---|---|
| PubChem CID | 117066290 |
| Molecular Formula | C25H36O5 |
| Molecular Weight | 416.56 g/mol |
| Exact Mass | 416.26 |
| IUPAC Name | [(17'S)-17'-acetyl-10',13'-dimethylspiro[1,3-dioxolane-2,3'-2,4,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene]-17'-yl] acetate |
| SMILES | CC(=O)O[C@@]1(C(C)=O)CCC2C3CC=C4CC5(CCC4(C)C3CCC21C)OCCO5 |
| InChI | InChI=1S/C25H36O5/c1-16(26)25(30-17(2)27)10-8-21-19-6-5-18-15-24(28-13-14-29-24)12-11-22(18,3)20(19)7-9-23(21,25)4/h5,19-21H,6-15H2,1-4H3/t19?,20?,21?,22?,23?,25-/m1/s1 |
| InChIKey | BSQMPBUBHHDZDS-AYOPJINSSA-N |
| XLogP | 4.58 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.56 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|