C23H32O3 — CID 131882874
1-[(8R,9S,10R,13S,14S)-10,13-dimethylspiro[1,2,4,7,8,9,11,12,14,15-decahydrocyclopenta[a]phenanthrene-3,2'-1,3-dioxolane]-17-yl]ethanone (PubChem CID 131882874) has the molecular formula C23H32O3 and a molecular weight of 356.51 g/mol. Its IUPAC name is 1-[(8R,9S,10R,13S,14S)-10,13-dimethylspiro[1,2,4,7,8,9,11,12,14,15-decahydrocyclopenta[a]phenanthrene-3,2'-1,3-dioxolane]-17-yl]ethanone.
| Compound Name | 1-[(8R,9S,10R,13S,14S)-10,13-dimethylspiro[1,2,4,7,8,9,11,12,14,15-decahydrocyclopenta[a]phenanthrene-3,2'-1,3-dioxolane]-17-yl]ethanone |
|---|---|
| PubChem CID | 131882874 |
| Molecular Formula | C23H32O3 |
| Molecular Weight | 356.51 g/mol |
| Exact Mass | 356.24 |
| IUPAC Name | 1-[(8R,9S,10R,13S,14S)-10,13-dimethylspiro[1,2,4,7,8,9,11,12,14,15-decahydrocyclopenta[a]phenanthrene-3,2'-1,3-dioxolane]-17-yl]ethanone |
| SMILES | CC(=O)C1=CC[C@H]2[C@@H]3CC=C4CC5(CC[C@]4(C)[C@H]3CC[C@]12C)OCCO5 |
| InChI | InChI=1S/C23H32O3/c1-15(24)18-6-7-19-17-5-4-16-14-23(25-12-13-26-23)11-10-21(16,2)20(17)8-9-22(18,19)3/h4,6,17,19-20H,5,7-14H2,1-3H3/t17-,19-,20-,21-,22+/m0/s1 |
| InChIKey | QZYSJZPRFQVEQX-JFZIVLOISA-N |
| XLogP | 4.82 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.51 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|