C22H32O3 — CID 40544151
CID 40544151 (PubChem CID 40544151) has the molecular formula C22H32O3 and a molecular weight of 344.50 g/mol.
| Compound Name | CID 40544151 |
|---|---|
| PubChem CID | 40544151 |
| Molecular Formula | C22H32O3 |
| Molecular Weight | 344.50 g/mol |
| Exact Mass | 344.24 |
| IUPAC Name | — |
| SMILES | C[C@]12CCC3(CC1=CC[C@H]1[C@H]2CC[C@@]2(C)[C@@H]1CC[C@@]21CO1)OCCO3 |
| InChI | InChI=1S/C22H32O3/c1-19-9-10-22(23-11-12-24-22)13-15(19)3-4-16-17(19)5-7-20(2)18(16)6-8-21(20)14-25-21/h3,16-18H,4-14H2,1-2H3/t16-,17+,18+,19-,20-,21+/m0/s1 |
| InChIKey | OULYBQZTBUFJRZ-ZUHHCLADSA-N |
| XLogP | 4.46 |
| TPSA | 30.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.50 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|