C26H42O4Si — CID 4518413
1-(10',13'-dimethyl-17'-trimethylsilyloxyspiro[1,3-dioxolane-2,3'-2,4,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene]-17'-yl)ethanone (PubChem CID 4518413) has the molecular formula C26H42O4Si and a molecular weight of 446.70 g/mol. Its IUPAC name is 1-(10',13'-dimethyl-17'-trimethylsilyloxyspiro[1,3-dioxolane-2,3'-2,4,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene]-17'-yl)ethanone.
| Compound Name | 1-(10',13'-dimethyl-17'-trimethylsilyloxyspiro[1,3-dioxolane-2,3'-2,4,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene]-17'-yl)ethanone |
|---|---|
| PubChem CID | 4518413 |
| Molecular Formula | C26H42O4Si |
| Molecular Weight | 446.70 g/mol |
| Exact Mass | 446.29 |
| IUPAC Name | 1-(10',13'-dimethyl-17'-trimethylsilyloxyspiro[1,3-dioxolane-2,3'-2,4,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene]-17'-yl)ethanone |
| SMILES | CC(=O)C1(O[Si](C)(C)C)CCC2C3CC=C4CC5(CCC4(C)C3CCC21C)OCCO5 |
| InChI | InChI=1S/C26H42O4Si/c1-18(27)26(30-31(4,5)6)12-10-22-20-8-7-19-17-25(28-15-16-29-25)14-13-23(19,2)21(20)9-11-24(22,26)3/h7,20-22H,8-17H2,1-6H3 |
| InChIKey | PSTZCHSKHUFSPW-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.70 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|