C24H33LiO5 — CID 173366603
lithium;hydride;3-[(8'R,9'S,10'R,13'S,14'S,17'S)-17'-hydroxy-10',13'-dimethylspiro[1,3-dioxolane-2,3'-2,4,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene]-17'-yl]prop-2-ynoic acid (PubChem CID 173366603) has the molecular formula C24H33LiO5 and a molecular weight of 408.46 g/mol. Its IUPAC name is lithium;hydride;3-[(8'R,9'S,10'R,13'S,14'S,17'S)-17'-hydroxy-10',13'-dimethylspiro[1,3-dioxolane-2,3'-2,4,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene]-17'-yl]prop-2-ynoic acid.
| Compound Name | lithium;hydride;3-[(8'R,9'S,10'R,13'S,14'S,17'S)-17'-hydroxy-10',13'-dimethylspiro[1,3-dioxolane-2,3'-2,4,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene]-17'-yl]prop-2-ynoic acid |
|---|---|
| PubChem CID | 173366603 |
| Molecular Formula | C24H33LiO5 |
| Molecular Weight | 408.46 g/mol |
| Exact Mass | 408.25 |
| IUPAC Name | lithium;hydride;3-[(8'R,9'S,10'R,13'S,14'S,17'S)-17'-hydroxy-10',13'-dimethylspiro[1,3-dioxolane-2,3'-2,4,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene]-17'-yl]prop-2-ynoic acid |
| SMILES | C[C@]12CCC3(CC1=CC[C@@H]1[C@@H]2CC[C@@]2(C)[C@H]1CC[C@@]2(O)C#CC(=O)O)OCCO3.[H-].[Li+] |
| InChI | InChI=1S/C24H32O5.Li.H/c1-21-11-12-24(28-13-14-29-24)15-16(21)3-4-17-18(21)5-8-22(2)19(17)6-9-23(22,27)10-7-20(25)26;;/h3,17-19,27H,4-6,8-9,11-15H2,1-2H3,(H,25,26);;/q;+1;-1/t17-,18+,19+,21+,22+,23-;;/m1../s1 |
| InChIKey | BVKIABNFGCPMTO-LXNFQHJCSA-N |
| XLogP | 0.63 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.46 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|