C28H45NO4 — CID 133269016
N,N-diethylethanamine;3-[(10S,13R,17R)-3,17-dihydroxy-10,13-dimethyl-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-yl]prop-2-ynoic acid (PubChem CID 133269016) has the molecular formula C28H45NO4 and a molecular weight of 459.67 g/mol. Its IUPAC name is N,N-diethylethanamine;3-[(10S,13R,17R)-3,17-dihydroxy-10,13-dimethyl-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-yl]prop-2-ynoic acid.
| Compound Name | N,N-diethylethanamine;3-[(10S,13R,17R)-3,17-dihydroxy-10,13-dimethyl-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-yl]prop-2-ynoic acid |
|---|---|
| PubChem CID | 133269016 |
| Molecular Formula | C28H45NO4 |
| Molecular Weight | 459.67 g/mol |
| Exact Mass | 459.33 |
| IUPAC Name | N,N-diethylethanamine;3-[(10S,13R,17R)-3,17-dihydroxy-10,13-dimethyl-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-yl]prop-2-ynoic acid |
| SMILES | CCN(CC)CC.C[C@@]12CCC(O)CC1=CCC1C2CC[C@]2(C)C1CC[C@]2(O)C#CC(=O)O |
| InChI | InChI=1S/C22H30O4.C6H15N/c1-20-9-5-15(23)13-14(20)3-4-16-17(20)6-10-21(2)18(16)7-11-22(21,26)12-8-19(24)25;1-4-7(5-2)6-3/h3,15-18,23,26H,4-7,9-11,13H2,1-2H3,(H,24,25);4-6H2,1-3H3/t15?,16?,17?,18?,20-,21-,22+;/m1./s1 |
| InChIKey | HVAGUVVKKNKZKA-VGNVPAAOSA-N |
| XLogP | 4.48 |
| TPSA | 81.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.67 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|