C23H36O8S — CID 70268624
(17-acetyl-3-hydroxy-10,13-dimethyl-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-yl) acetate;sulfuric acid (PubChem CID 70268624) has the molecular formula C23H36O8S and a molecular weight of 472.60 g/mol. Its IUPAC name is (17-acetyl-3-hydroxy-10,13-dimethyl-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-yl) acetate;sulfuric acid.
| Compound Name | (17-acetyl-3-hydroxy-10,13-dimethyl-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-yl) acetate;sulfuric acid |
|---|---|
| PubChem CID | 70268624 |
| Molecular Formula | C23H36O8S |
| Molecular Weight | 472.60 g/mol |
| Exact Mass | 472.21 |
| IUPAC Name | (17-acetyl-3-hydroxy-10,13-dimethyl-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-yl) acetate;sulfuric acid |
| SMILES | CC(=O)OC1(C(C)=O)CCC2C3CC=C4CC(O)CCC4(C)C3CCC21C.O=S(=O)(O)O |
| InChI | InChI=1S/C23H34O4.H2O4S/c1-14(24)23(27-15(2)25)12-9-20-18-6-5-16-13-17(26)7-10-21(16,3)19(18)8-11-22(20,23)4;1-5(2,3)4/h5,17-20,26H,6-13H2,1-4H3;(H2,1,2,3,4) |
| InChIKey | NVVMJJJCEPQCIK-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 138.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.60 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|