C29H40O3 — CID 121349212
1-[(3S,8R,9S,10R,13S,14S,17R)-17-benzyl-3-hydroxy-3-methoxy-10,13-dimethyl-2,4,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-yl]ethanone (PubChem CID 121349212) has the molecular formula C29H40O3 and a molecular weight of 436.64 g/mol. Its IUPAC name is 1-[(3S,8R,9S,10R,13S,14S,17R)-17-benzyl-3-hydroxy-3-methoxy-10,13-dimethyl-2,4,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-yl]ethanone.
| Compound Name | 1-[(3S,8R,9S,10R,13S,14S,17R)-17-benzyl-3-hydroxy-3-methoxy-10,13-dimethyl-2,4,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-yl]ethanone |
|---|---|
| PubChem CID | 121349212 |
| Molecular Formula | C29H40O3 |
| Molecular Weight | 436.64 g/mol |
| Exact Mass | 436.30 |
| IUPAC Name | 1-[(3S,8R,9S,10R,13S,14S,17R)-17-benzyl-3-hydroxy-3-methoxy-10,13-dimethyl-2,4,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-yl]ethanone |
| SMILES | CO[C@@]1(O)CC[C@@]2(C)C(=CC[C@@H]3[C@@H]2CC[C@@]2(C)[C@H]3CC[C@]2(Cc2ccccc2)C(C)=O)C1 |
| InChI | InChI=1S/C29H40O3/c1-20(30)28(18-21-8-6-5-7-9-21)15-13-25-23-11-10-22-19-29(31,32-4)17-16-26(22,2)24(23)12-14-27(25,28)3/h5-10,23-25,31H,11-19H2,1-4H3/t23-,24+,25+,26+,27+,28+,29+/m1/s1 |
| InChIKey | DFCZBYPHDUDCFI-KVARLTFLSA-N |
| XLogP | 6.10 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.64 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|