C30H42O4 — CID 90189076
1-[3-[(4-ethoxyphenyl)methoxy]-3-hydroxy-10,13-dimethyl-1,2,4,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl]ethanone (PubChem CID 90189076) has the molecular formula C30H42O4 and a molecular weight of 466.66 g/mol. Its IUPAC name is 1-[3-[(4-ethoxyphenyl)methoxy]-3-hydroxy-10,13-dimethyl-1,2,4,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl]ethanone.
| Compound Name | 1-[3-[(4-ethoxyphenyl)methoxy]-3-hydroxy-10,13-dimethyl-1,2,4,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl]ethanone |
|---|---|
| PubChem CID | 90189076 |
| Molecular Formula | C30H42O4 |
| Molecular Weight | 466.66 g/mol |
| Exact Mass | 466.31 |
| IUPAC Name | 1-[3-[(4-ethoxyphenyl)methoxy]-3-hydroxy-10,13-dimethyl-1,2,4,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl]ethanone |
| SMILES | CCOc1ccc(COC2(O)CCC3(C)C(=CCC4C3CCC3(C)C(C(C)=O)CCC43)C2)cc1 |
| InChI | InChI=1S/C30H42O4/c1-5-33-23-9-6-21(7-10-23)19-34-30(32)17-16-28(3)22(18-30)8-11-24-26-13-12-25(20(2)31)29(26,4)15-14-27(24)28/h6-10,24-27,32H,5,11-19H2,1-4H3 |
| InChIKey | PENPFJNTAULJMZ-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.66 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|