C22H33FO2 — CID 121349206
1-[(3S,8R,9S,10R,13S,14S,17S)-3-fluoro-3-hydroxy-10,13,17-trimethyl-2,4,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-yl]ethanone (PubChem CID 121349206) has the molecular formula C22H33FO2 and a molecular weight of 348.50 g/mol. Its IUPAC name is 1-[(3S,8R,9S,10R,13S,14S,17S)-3-fluoro-3-hydroxy-10,13,17-trimethyl-2,4,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-yl]ethanone.
| Compound Name | 1-[(3S,8R,9S,10R,13S,14S,17S)-3-fluoro-3-hydroxy-10,13,17-trimethyl-2,4,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-yl]ethanone |
|---|---|
| PubChem CID | 121349206 |
| Molecular Formula | C22H33FO2 |
| Molecular Weight | 348.50 g/mol |
| Exact Mass | 348.25 |
| IUPAC Name | 1-[(3S,8R,9S,10R,13S,14S,17S)-3-fluoro-3-hydroxy-10,13,17-trimethyl-2,4,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-yl]ethanone |
| SMILES | CC(=O)[C@@]1(C)CC[C@H]2[C@@H]3CC=C4C[C@@](O)(F)CC[C@]4(C)[C@H]3CC[C@@]21C |
| InChI | InChI=1S/C22H33FO2/c1-14(24)20(3)9-8-18-16-6-5-15-13-22(23,25)12-11-19(15,2)17(16)7-10-21(18,20)4/h5,16-18,25H,6-13H2,1-4H3/t16-,17+,18+,19+,20-,21+,22-/m1/s1 |
| InChIKey | ICJQHHAKQIERMZ-TZRZLIMKSA-N |
| XLogP | 5.20 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.50 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|