C22H33FO — CID 130253644
1-[(13S,17S)-3-fluoro-10,13,17-trimethyl-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-yl]ethanone (PubChem CID 130253644) has the molecular formula C22H33FO and a molecular weight of 332.50 g/mol. Its IUPAC name is 1-[(13S,17S)-3-fluoro-10,13,17-trimethyl-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-yl]ethanone.
| Compound Name | 1-[(13S,17S)-3-fluoro-10,13,17-trimethyl-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-yl]ethanone |
|---|---|
| PubChem CID | 130253644 |
| Molecular Formula | C22H33FO |
| Molecular Weight | 332.50 g/mol |
| Exact Mass | 332.25 |
| IUPAC Name | 1-[(13S,17S)-3-fluoro-10,13,17-trimethyl-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-yl]ethanone |
| SMILES | CC(=O)[C@@]1(C)CCC2C3CC=C4CC(F)CCC4(C)C3CC[C@@]21C |
| InChI | InChI=1S/C22H33FO/c1-14(24)21(3)11-9-19-17-6-5-15-13-16(23)7-10-20(15,2)18(17)8-12-22(19,21)4/h5,16-19H,6-13H2,1-4H3/t16?,17?,18?,19?,20?,21-,22+/m1/s1 |
| InChIKey | AVLUHVMCJQWYOT-XDPGLMMESA-N |
| XLogP | 5.88 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.50 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|