C30H38O3 — CID 71401421
[(3S,8S,9S,10R,13R,14S,17S)-10,13-dimethyl-17-(3-phenylprop-2-enoyl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate (PubChem CID 71401421) has the molecular formula C30H38O3 and a molecular weight of 446.63 g/mol. Its IUPAC name is [(3S,8S,9S,10R,13R,14S,17S)-10,13-dimethyl-17-(3-phenylprop-2-enoyl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate.
| Compound Name | [(3S,8S,9S,10R,13R,14S,17S)-10,13-dimethyl-17-(3-phenylprop-2-enoyl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate |
|---|---|
| PubChem CID | 71401421 |
| Molecular Formula | C30H38O3 |
| Molecular Weight | 446.63 g/mol |
| Exact Mass | 446.28 |
| IUPAC Name | [(3S,8S,9S,10R,13R,14S,17S)-10,13-dimethyl-17-(3-phenylprop-2-enoyl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate |
| SMILES | CC(=O)O[C@H]1CC[C@@]2(C)C(=CC[C@H]3[C@@H]4CC[C@H](C(=O)C=Cc5ccccc5)[C@]4(C)CC[C@@H]32)C1 |
| InChI | InChI=1S/C30H38O3/c1-20(31)33-23-15-17-29(2)22(19-23)10-11-24-25-12-13-27(30(25,3)18-16-26(24)29)28(32)14-9-21-7-5-4-6-8-21/h4-10,14,23-27H,11-13,15-19H2,1-3H3/t23-,24-,25-,26-,27+,29-,30+/m0/s1 |
| InChIKey | FPGBQRAYOLMBRS-YVQQVAMCSA-N |
| XLogP | 6.78 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.63 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|