C30H37BrO3 — CID 71615257
[(3S,8S,9S,10R,13S,14S,17S)-17-[(E)-3-(2-bromophenyl)prop-2-enoyl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate (PubChem CID 71615257) has the molecular formula C30H37BrO3 and a molecular weight of 525.53 g/mol. Its IUPAC name is [(3S,8S,9S,10R,13S,14S,17S)-17-[(E)-3-(2-bromophenyl)prop-2-enoyl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate.
| Compound Name | [(3S,8S,9S,10R,13S,14S,17S)-17-[(E)-3-(2-bromophenyl)prop-2-enoyl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate |
|---|---|
| PubChem CID | 71615257 |
| Molecular Formula | C30H37BrO3 |
| Molecular Weight | 525.53 g/mol |
| Exact Mass | 524.19 |
| IUPAC Name | [(3S,8S,9S,10R,13S,14S,17S)-17-[(E)-3-(2-bromophenyl)prop-2-enoyl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate |
| SMILES | CC(=O)O[C@H]1CC[C@@]2(C)C(=CC[C@H]3[C@@H]4CC[C@H](C(=O)/C=C/c5ccccc5Br)[C@@]4(C)CC[C@@H]32)C1 |
| InChI | InChI=1S/C30H37BrO3/c1-19(32)34-22-14-16-29(2)21(18-22)9-10-23-24-11-12-26(30(24,3)17-15-25(23)29)28(33)13-8-20-6-4-5-7-27(20)31/h4-9,13,22-26H,10-12,14-18H2,1-3H3/b13-8+/t22-,23-,24-,25-,26+,29-,30-/m0/s1 |
| InChIKey | ARBHIDGIBITHCF-XZYAFWEPSA-N |
| XLogP | 7.54 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.53 |
| LogP ≤ 5 | 7.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|