C23H32N2O3 — CID 11877496
[(3S,8S,9R,10R,13S,14S,17S)-17-(2-diazoacetyl)-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate (PubChem CID 11877496) has the molecular formula C23H32N2O3 and a molecular weight of 384.52 g/mol. Its IUPAC name is [(3S,8S,9R,10R,13S,14S,17S)-17-(2-diazoacetyl)-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate.
| Compound Name | [(3S,8S,9R,10R,13S,14S,17S)-17-(2-diazoacetyl)-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate |
|---|---|
| PubChem CID | 11877496 |
| Molecular Formula | C23H32N2O3 |
| Molecular Weight | 384.52 g/mol |
| Exact Mass | 384.24 |
| IUPAC Name | [(3S,8S,9R,10R,13S,14S,17S)-17-(2-diazoacetyl)-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate |
| SMILES | CC(=O)O[C@H]1CC[C@@]2(C)C(=CC[C@@H]3[C@H]2CC[C@]2(C)[C@@H](C(=O)C=[N+]=[N-])CC[C@@H]32)C1 |
| InChI | InChI=1S/C23H32N2O3/c1-14(26)28-16-8-10-22(2)15(12-16)4-5-17-18-6-7-20(21(27)13-25-24)23(18,3)11-9-19(17)22/h4,13,16-20H,5-12H2,1-3H3/t16-,17-,18-,19+,20+,22-,23-/m0/s1 |
| InChIKey | VZJASVVRXMLTSG-UMDFJOQQSA-N |
| XLogP | 4.37 |
| TPSA | 79.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.52 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|