C28H42O4 — CID 99574956
cyclohexyl (3R,8S,9S,10R,13S,14S,17S)-3-acetyloxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-17-carboxylate (PubChem CID 99574956) has the molecular formula C28H42O4 and a molecular weight of 442.64 g/mol. Its IUPAC name is cyclohexyl (3R,8S,9S,10R,13S,14S,17S)-3-acetyloxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-17-carboxylate.
| Compound Name | cyclohexyl (3R,8S,9S,10R,13S,14S,17S)-3-acetyloxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-17-carboxylate |
|---|---|
| PubChem CID | 99574956 |
| Molecular Formula | C28H42O4 |
| Molecular Weight | 442.64 g/mol |
| Exact Mass | 442.31 |
| IUPAC Name | cyclohexyl (3R,8S,9S,10R,13S,14S,17S)-3-acetyloxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-17-carboxylate |
| SMILES | CC(=O)O[C@@H]1CC[C@@]2(C)C(=CC[C@H]3[C@@H]4CC[C@H](C(=O)OC5CCCCC5)[C@@]4(C)CC[C@@H]32)C1 |
| InChI | InChI=1S/C28H42O4/c1-18(29)31-21-13-15-27(2)19(17-21)9-10-22-23-11-12-25(28(23,3)16-14-24(22)27)26(30)32-20-7-5-4-6-8-20/h9,20-25H,4-8,10-17H2,1-3H3/t21-,22+,23+,24+,25-,27+,28+/m1/s1 |
| InChIKey | PSZQIJKWYLUAAC-HAUQEPAVSA-N |
| XLogP | 6.37 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.64 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|