C30H37NO5 — CID 99574703
[(3R,8S,9S,10R,13S,14S,17S)-10,13-dimethyl-17-[(E)-3-(3-nitrophenyl)prop-2-enoyl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate (PubChem CID 99574703) has the molecular formula C30H37NO5 and a molecular weight of 491.63 g/mol. Its IUPAC name is [(3R,8S,9S,10R,13S,14S,17S)-10,13-dimethyl-17-[(E)-3-(3-nitrophenyl)prop-2-enoyl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate.
| Compound Name | [(3R,8S,9S,10R,13S,14S,17S)-10,13-dimethyl-17-[(E)-3-(3-nitrophenyl)prop-2-enoyl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate |
|---|---|
| PubChem CID | 99574703 |
| Molecular Formula | C30H37NO5 |
| Molecular Weight | 491.63 g/mol |
| Exact Mass | 491.27 |
| IUPAC Name | [(3R,8S,9S,10R,13S,14S,17S)-10,13-dimethyl-17-[(E)-3-(3-nitrophenyl)prop-2-enoyl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate |
| SMILES | CC(=O)O[C@@H]1CC[C@@]2(C)C(=CC[C@H]3[C@@H]4CC[C@H](C(=O)/C=C/c5cccc([N+](=O)[O-])c5)[C@@]4(C)CC[C@@H]32)C1 |
| InChI | InChI=1S/C30H37NO5/c1-19(32)36-23-13-15-29(2)21(18-23)8-9-24-25-10-11-27(30(25,3)16-14-26(24)29)28(33)12-7-20-5-4-6-22(17-20)31(34)35/h4-8,12,17,23-27H,9-11,13-16,18H2,1-3H3/b12-7+/t23-,24+,25+,26+,27-,29+,30+/m1/s1 |
| InChIKey | NJTDPGNBYCUNCW-BZVVKATESA-N |
| XLogP | 6.69 |
| TPSA | 86.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.63 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|