C31H41NO4 — CID 6111163
[17-[(E)-3-(4-methoxyanilino)prop-2-enoyl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate (PubChem CID 6111163) has the molecular formula C31H41NO4 and a molecular weight of 491.67 g/mol. Its IUPAC name is [17-[(E)-3-(4-methoxyanilino)prop-2-enoyl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate.
| Compound Name | [17-[(E)-3-(4-methoxyanilino)prop-2-enoyl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate |
|---|---|
| PubChem CID | 6111163 |
| Molecular Formula | C31H41NO4 |
| Molecular Weight | 491.67 g/mol |
| Exact Mass | 491.30 |
| IUPAC Name | [17-[(E)-3-(4-methoxyanilino)prop-2-enoyl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate |
| SMILES | COc1ccc(N/C=C/C(=O)C2CCC3C4CC=C5CC(OC(C)=O)CCC5(C)C4CCC23C)cc1 |
| InChI | InChI=1S/C31H41NO4/c1-20(33)36-24-13-16-30(2)21(19-24)5-10-25-26-11-12-28(31(26,3)17-14-27(25)30)29(34)15-18-32-22-6-8-23(35-4)9-7-22/h5-9,15,18,24-28,32H,10-14,16-17,19H2,1-4H3/b18-15+ |
| InChIKey | FSSOAAYBEBLGEK-OBGWFSINSA-N |
| XLogP | 6.70 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.67 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|