C32H42O5 — CID 71615649
[(3S,8S,9S,10R,13S,14S,17S)-17-[(E)-3-(2,4-dimethoxyphenyl)prop-2-enoyl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate (PubChem CID 71615649) has the molecular formula C32H42O5 and a molecular weight of 506.68 g/mol. Its IUPAC name is [(3S,8S,9S,10R,13S,14S,17S)-17-[(E)-3-(2,4-dimethoxyphenyl)prop-2-enoyl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate.
| Compound Name | [(3S,8S,9S,10R,13S,14S,17S)-17-[(E)-3-(2,4-dimethoxyphenyl)prop-2-enoyl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate |
|---|---|
| PubChem CID | 71615649 |
| Molecular Formula | C32H42O5 |
| Molecular Weight | 506.68 g/mol |
| Exact Mass | 506.30 |
| IUPAC Name | [(3S,8S,9S,10R,13S,14S,17S)-17-[(E)-3-(2,4-dimethoxyphenyl)prop-2-enoyl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate |
| SMILES | COc1ccc(/C=C/C(=O)[C@H]2CC[C@H]3[C@@H]4CC=C5C[C@@H](OC(C)=O)CC[C@]5(C)[C@H]4CC[C@]23C)c(OC)c1 |
| InChI | InChI=1S/C32H42O5/c1-20(33)37-24-14-16-31(2)22(18-24)8-10-25-26-11-12-28(32(26,3)17-15-27(25)31)29(34)13-7-21-6-9-23(35-4)19-30(21)36-5/h6-9,13,19,24-28H,10-12,14-18H2,1-5H3/b13-7+/t24-,25-,26-,27-,28+,31-,32-/m0/s1 |
| InChIKey | VJYFXIJAWUXSRC-VJIHWLDESA-N |
| XLogP | 6.80 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.68 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|