C30H40O4 — CID 71616722
(E)-3-(2,5-dimethoxyphenyl)-1-(3-hydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl)prop-2-en-1-one (PubChem CID 71616722) has the molecular formula C30H40O4 and a molecular weight of 464.65 g/mol. Its IUPAC name is (E)-3-(2,5-dimethoxyphenyl)-1-(3-hydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl)prop-2-en-1-one.
| Compound Name | (E)-3-(2,5-dimethoxyphenyl)-1-(3-hydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 71616722 |
| Molecular Formula | C30H40O4 |
| Molecular Weight | 464.65 g/mol |
| Exact Mass | 464.29 |
| IUPAC Name | (E)-3-(2,5-dimethoxyphenyl)-1-(3-hydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl)prop-2-en-1-one |
| SMILES | COc1ccc(OC)c(/C=C/C(=O)C2CCC3C4CC=C5CC(O)CCC5(C)C4CCC23C)c1 |
| InChI | InChI=1S/C30H40O4/c1-29-15-13-21(31)18-20(29)6-8-23-24-9-10-26(30(24,2)16-14-25(23)29)27(32)11-5-19-17-22(33-3)7-12-28(19)34-4/h5-7,11-12,17,21,23-26,31H,8-10,13-16,18H2,1-4H3/b11-5+ |
| InChIKey | YWVQZSSLWSQGJF-VZUCSPMQSA-N |
| XLogP | 6.23 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.65 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|