C35H40O2 — CID 163201829
(E)-3-(9H-fluoren-2-yl)-1-[(3S,10R,13S)-3-hydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]prop-2-en-1-one (PubChem CID 163201829) has the molecular formula C35H40O2 and a molecular weight of 492.70 g/mol. Its IUPAC name is (E)-3-(9H-fluoren-2-yl)-1-[(3S,10R,13S)-3-hydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]prop-2-en-1-one.
| Compound Name | (E)-3-(9H-fluoren-2-yl)-1-[(3S,10R,13S)-3-hydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 163201829 |
| Molecular Formula | C35H40O2 |
| Molecular Weight | 492.70 g/mol |
| Exact Mass | 492.30 |
| IUPAC Name | (E)-3-(9H-fluoren-2-yl)-1-[(3S,10R,13S)-3-hydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]prop-2-en-1-one |
| SMILES | C[C@]12CCC3C(CC=C4C[C@@H](O)CC[C@@]43C)C1CCC2C(=O)/C=C/c1ccc2c(c1)Cc1ccccc1-2 |
| InChI | InChI=1S/C35H40O2/c1-34-17-15-26(36)21-25(34)9-11-29-30-12-13-32(35(30,2)18-16-31(29)34)33(37)14-8-22-7-10-28-24(19-22)20-23-5-3-4-6-27(23)28/h3-10,14,19,26,29-32,36H,11-13,15-18,20-21H2,1-2H3/b14-8+/t26-,29?,30?,31?,32?,34-,35-/m0/s1 |
| InChIKey | SZCYBJDNTFRHBG-VBKRIBDGSA-N |
| XLogP | 7.78 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.70 |
| LogP ≤ 5 | 7.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|