C28H35ClO2 — CID 56850430
(E)-3-(2-chlorophenyl)-1-[(3S,8S,9S,10R,13S,14S,17S)-3-hydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]prop-2-en-1-one (PubChem CID 56850430) has the molecular formula C28H35ClO2 and a molecular weight of 439.04 g/mol. Its IUPAC name is (E)-3-(2-chlorophenyl)-1-[(3S,8S,9S,10R,13S,14S,17S)-3-hydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]prop-2-en-1-one.
| Compound Name | (E)-3-(2-chlorophenyl)-1-[(3S,8S,9S,10R,13S,14S,17S)-3-hydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 56850430 |
| Molecular Formula | C28H35ClO2 |
| Molecular Weight | 439.04 g/mol |
| Exact Mass | 438.23 |
| IUPAC Name | (E)-3-(2-chlorophenyl)-1-[(3S,8S,9S,10R,13S,14S,17S)-3-hydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]prop-2-en-1-one |
| SMILES | C[C@]12CC[C@H]3[C@@H](CC=C4C[C@@H](O)CC[C@@]43C)[C@@H]1CC[C@@H]2C(=O)/C=C/c1ccccc1Cl |
| InChI | InChI=1S/C28H35ClO2/c1-27-15-13-20(30)17-19(27)8-9-21-22-10-11-24(28(22,2)16-14-23(21)27)26(31)12-7-18-5-3-4-6-25(18)29/h3-8,12,20-24,30H,9-11,13-17H2,1-2H3/b12-7+/t20-,21-,22-,23-,24+,27-,28-/m0/s1 |
| InChIKey | ASZKWZYPTSFZRP-SDVMSRBFSA-N |
| XLogP | 6.86 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.04 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|