C26H41NO3 — CID 58483127
[(3R,10R,13S,17S)-17-acetyl-10,13-dimethyl-2,3,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] (2S)-2-amino-3-methylbutanoate (PubChem CID 58483127) has the molecular formula C26H41NO3 and a molecular weight of 415.62 g/mol. Its IUPAC name is [(3R,10R,13S,17S)-17-acetyl-10,13-dimethyl-2,3,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] (2S)-2-amino-3-methylbutanoate.
| Compound Name | [(3R,10R,13S,17S)-17-acetyl-10,13-dimethyl-2,3,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] (2S)-2-amino-3-methylbutanoate |
|---|---|
| PubChem CID | 58483127 |
| Molecular Formula | C26H41NO3 |
| Molecular Weight | 415.62 g/mol |
| Exact Mass | 415.31 |
| IUPAC Name | [(3R,10R,13S,17S)-17-acetyl-10,13-dimethyl-2,3,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] (2S)-2-amino-3-methylbutanoate |
| SMILES | CC(=O)[C@H]1CCC2C3CCC4=C[C@H](OC(=O)[C@@H](N)C(C)C)CC[C@]4(C)C3CC[C@@]21C |
| InChI | InChI=1S/C26H41NO3/c1-15(2)23(27)24(29)30-18-10-12-25(4)17(14-18)6-7-19-21-9-8-20(16(3)28)26(21,5)13-11-22(19)25/h14-15,18-23H,6-13,27H2,1-5H3/t18-,19?,20-,21?,22?,23+,25+,26-/m1/s1 |
| InChIKey | YIRDSBUNWRKQHW-IWEPWFAGSA-N |
| XLogP | 5.05 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.62 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|