C22H30O4 — CID 68648409
methyl [(7R,8R,9R,10R,11S,13S,17S)-7,11,13-trimethyl-3-oxo-2,6,7,8,9,10,11,12,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl] carbonate (PubChem CID 68648409) has the molecular formula C22H30O4 and a molecular weight of 358.48 g/mol. Its IUPAC name is methyl [(7R,8R,9R,10R,11S,13S,17S)-7,11,13-trimethyl-3-oxo-2,6,7,8,9,10,11,12,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl] carbonate.
| Compound Name | methyl [(7R,8R,9R,10R,11S,13S,17S)-7,11,13-trimethyl-3-oxo-2,6,7,8,9,10,11,12,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl] carbonate |
|---|---|
| PubChem CID | 68648409 |
| Molecular Formula | C22H30O4 |
| Molecular Weight | 358.48 g/mol |
| Exact Mass | 358.21 |
| IUPAC Name | methyl [(7R,8R,9R,10R,11S,13S,17S)-7,11,13-trimethyl-3-oxo-2,6,7,8,9,10,11,12,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl] carbonate |
| SMILES | COC(=O)O[C@H]1CC=C2[C@H]3[C@H]([C@@H](C)C[C@@]21C)[C@H]1CCC(=O)C=C1C[C@H]3C |
| InChI | InChI=1S/C22H30O4/c1-12-9-14-10-15(23)5-6-16(14)19-13(2)11-22(3)17(20(12)19)7-8-18(22)26-21(24)25-4/h7,10,12-13,16,18-20H,5-6,8-9,11H2,1-4H3/t12-,13+,16+,18+,19-,20+,22+/m1/s1 |
| InChIKey | QUFVWAYHVBFFRM-XHYWVQGJSA-N |
| XLogP | 4.69 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.48 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|