C23H34O3 — CID 91543719
[(8R,9S,10R,13S,14S,17R)-17-ethyl-11,13-dimethyl-3-oxo-1,2,6,7,8,9,10,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-yl] acetate (PubChem CID 91543719) has the molecular formula C23H34O3 and a molecular weight of 358.52 g/mol. Its IUPAC name is [(8R,9S,10R,13S,14S,17R)-17-ethyl-11,13-dimethyl-3-oxo-1,2,6,7,8,9,10,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-yl] acetate.
| Compound Name | [(8R,9S,10R,13S,14S,17R)-17-ethyl-11,13-dimethyl-3-oxo-1,2,6,7,8,9,10,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-yl] acetate |
|---|---|
| PubChem CID | 91543719 |
| Molecular Formula | C23H34O3 |
| Molecular Weight | 358.52 g/mol |
| Exact Mass | 358.25 |
| IUPAC Name | [(8R,9S,10R,13S,14S,17R)-17-ethyl-11,13-dimethyl-3-oxo-1,2,6,7,8,9,10,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-yl] acetate |
| SMILES | CC[C@@]1(OC(C)=O)CC[C@H]2[C@@H]3CCC4=CC(=O)CC[C@@H]4[C@H]3C(C)C[C@@]21C |
| InChI | InChI=1S/C23H34O3/c1-5-23(26-15(3)24)11-10-20-19-8-6-16-12-17(25)7-9-18(16)21(19)14(2)13-22(20,23)4/h12,14,18-21H,5-11,13H2,1-4H3/t14?,18-,19-,20-,21+,22-,23+/m0/s1 |
| InChIKey | KWODQHFCSFCKFF-SEAHRMNOSA-N |
| XLogP | 5.09 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.52 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |