C22H31ClO — CID 11688818
(4aR,4bS,5S,7R,10aS,10bR)-8-chloro-6a-ethyl-5,7-dimethyl-3,4,4a,4b,5,6,7,10,10a,10b,11,12-dodecahydrochrysen-2-one (PubChem CID 11688818) has the molecular formula C22H31ClO and a molecular weight of 346.94 g/mol. Its IUPAC name is (4aR,4bS,5S,7R,10aS,10bR)-8-chloro-6a-ethyl-5,7-dimethyl-3,4,4a,4b,5,6,7,10,10a,10b,11,12-dodecahydrochrysen-2-one.
| Compound Name | (4aR,4bS,5S,7R,10aS,10bR)-8-chloro-6a-ethyl-5,7-dimethyl-3,4,4a,4b,5,6,7,10,10a,10b,11,12-dodecahydrochrysen-2-one |
|---|---|
| PubChem CID | 11688818 |
| Molecular Formula | C22H31ClO |
| Molecular Weight | 346.94 g/mol |
| Exact Mass | 346.21 |
| IUPAC Name | (4aR,4bS,5S,7R,10aS,10bR)-8-chloro-6a-ethyl-5,7-dimethyl-3,4,4a,4b,5,6,7,10,10a,10b,11,12-dodecahydrochrysen-2-one |
| SMILES | CCC12C[C@H](C)[C@H]3[C@@H](CCC4=CC(=O)CC[C@@H]43)[C@@H]1CC=C(Cl)[C@@H]2C |
| InChI | InChI=1S/C22H31ClO/c1-4-22-12-13(2)21-17-8-6-16(24)11-15(17)5-7-18(21)19(22)9-10-20(23)14(22)3/h10-11,13-14,17-19,21H,4-9,12H2,1-3H3/t13-,14-,17-,18-,19-,21+,22?/m0/s1 |
| InChIKey | SFMPITNXAZETBK-LBWZGENDSA-N |
| XLogP | 6.13 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.94 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |