C20H27FO2 — CID 57304274
(8R,9S,10R,11R,13S,14S)-11-(2-fluoroethyl)-13-methyl-1,2,6,7,8,9,10,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene-3,17-dione (PubChem CID 57304274) has the molecular formula C20H27FO2 and a molecular weight of 318.43 g/mol. Its IUPAC name is (8R,9S,10R,11R,13S,14S)-11-(2-fluoroethyl)-13-methyl-1,2,6,7,8,9,10,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene-3,17-dione.
| Compound Name | (8R,9S,10R,11R,13S,14S)-11-(2-fluoroethyl)-13-methyl-1,2,6,7,8,9,10,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene-3,17-dione |
|---|---|
| PubChem CID | 57304274 |
| Molecular Formula | C20H27FO2 |
| Molecular Weight | 318.43 g/mol |
| Exact Mass | 318.20 |
| IUPAC Name | (8R,9S,10R,11R,13S,14S)-11-(2-fluoroethyl)-13-methyl-1,2,6,7,8,9,10,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene-3,17-dione |
| SMILES | C[C@]12C[C@H](CCF)[C@H]3[C@@H](CCC4=CC(=O)CC[C@@H]43)[C@@H]1CCC2=O |
| InChI | InChI=1S/C20H27FO2/c1-20-11-13(8-9-21)19-15-5-3-14(22)10-12(15)2-4-16(19)17(20)6-7-18(20)23/h10,13,15-17,19H,2-9,11H2,1H3/t13-,15-,16-,17-,19+,20-/m0/s1 |
| InChIKey | PYPQLEOVXNIHOA-RDNJYJPESA-N |
| XLogP | 4.28 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.43 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |