C24H34ClFO2 — CID 57267237
(8S,9S,10R,13S,14S)-7-(6-chlorohexyl)-11-fluoro-13-methyl-1,2,6,7,8,9,10,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene-3,17-dione (PubChem CID 57267237) has the molecular formula C24H34ClFO2 and a molecular weight of 408.99 g/mol. Its IUPAC name is (8S,9S,10R,13S,14S)-7-(6-chlorohexyl)-11-fluoro-13-methyl-1,2,6,7,8,9,10,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene-3,17-dione.
| Compound Name | (8S,9S,10R,13S,14S)-7-(6-chlorohexyl)-11-fluoro-13-methyl-1,2,6,7,8,9,10,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene-3,17-dione |
|---|---|
| PubChem CID | 57267237 |
| Molecular Formula | C24H34ClFO2 |
| Molecular Weight | 408.99 g/mol |
| Exact Mass | 408.22 |
| IUPAC Name | (8S,9S,10R,13S,14S)-7-(6-chlorohexyl)-11-fluoro-13-methyl-1,2,6,7,8,9,10,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene-3,17-dione |
| SMILES | C[C@]12CC(F)[C@H]3[C@@H](C(CCCCCCCl)CC4=CC(=O)CC[C@@H]43)[C@@H]1CCC2=O |
| InChI | InChI=1S/C24H34ClFO2/c1-24-14-20(26)23-18-8-7-17(27)13-16(18)12-15(6-4-2-3-5-11-25)22(23)19(24)9-10-21(24)28/h13,15,18-20,22-23H,2-12,14H2,1H3/t15?,18-,19-,20?,22-,23-,24-/m0/s1 |
| InChIKey | BUSHAYROOKNMRB-OSBSMHFZSA-N |
| XLogP | 6.06 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.99 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|