C33H52FNO2 — CID 57288516
(8S,9S,13S,14S)-11-fluoro-3-hydroxy-13-methyl-7-[5-[methyl(nonyl)amino]pentyl]-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one (PubChem CID 57288516) has the molecular formula C33H52FNO2 and a molecular weight of 513.78 g/mol. Its IUPAC name is (8S,9S,13S,14S)-11-fluoro-3-hydroxy-13-methyl-7-[5-[methyl(nonyl)amino]pentyl]-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one.
| Compound Name | (8S,9S,13S,14S)-11-fluoro-3-hydroxy-13-methyl-7-[5-[methyl(nonyl)amino]pentyl]-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one |
|---|---|
| PubChem CID | 57288516 |
| Molecular Formula | C33H52FNO2 |
| Molecular Weight | 513.78 g/mol |
| Exact Mass | 513.40 |
| IUPAC Name | (8S,9S,13S,14S)-11-fluoro-3-hydroxy-13-methyl-7-[5-[methyl(nonyl)amino]pentyl]-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one |
| SMILES | CCCCCCCCCN(C)CCCCCC1Cc2cc(O)ccc2[C@H]2C(F)C[C@]3(C)C(=O)CC[C@H]3[C@H]12 |
| InChI | InChI=1S/C33H52FNO2/c1-4-5-6-7-8-9-12-19-35(3)20-13-10-11-14-24-21-25-22-26(36)15-16-27(25)32-29(34)23-33(2)28(31(24)32)17-18-30(33)37/h15-16,22,24,28-29,31-32,36H,4-14,17-21,23H2,1-3H3/t24?,28-,29?,31-,32-,33-/m0/s1 |
| InChIKey | WKIALJLXTQBQCM-XMQCXYNMSA-N |
| XLogP | 8.23 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.78 |
| LogP ≤ 5 | 8.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|