C35H49F10NO2 — CID 10283599
11-fluoro-13,17-dimethyl-7-[5-[methyl(7,7,8,8,9,9,10,10,10-nonafluorodecyl)amino]pentyl]-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-3,17-diol (PubChem CID 10283599) has the molecular formula C35H49F10NO2 and a molecular weight of 705.76 g/mol. Its IUPAC name is 11-fluoro-13,17-dimethyl-7-[5-[methyl(7,7,8,8,9,9,10,10,10-nonafluorodecyl)amino]pentyl]-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-3,17-diol.
| Compound Name | 11-fluoro-13,17-dimethyl-7-[5-[methyl(7,7,8,8,9,9,10,10,10-nonafluorodecyl)amino]pentyl]-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-3,17-diol |
|---|---|
| PubChem CID | 10283599 |
| Molecular Formula | C35H49F10NO2 |
| Molecular Weight | 705.76 g/mol |
| Exact Mass | 705.36 |
| IUPAC Name | 11-fluoro-13,17-dimethyl-7-[5-[methyl(7,7,8,8,9,9,10,10,10-nonafluorodecyl)amino]pentyl]-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-3,17-diol |
| SMILES | CN(CCCCCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)F)CCCCCC1Cc2cc(O)ccc2C2C(F)CC3(C)C(CCC3(C)O)C12 |
| InChI | InChI=1S/C35H49F10NO2/c1-30-21-27(36)29-25-13-12-24(47)20-23(25)19-22(28(29)26(30)14-16-31(30,2)48)11-7-6-10-18-46(3)17-9-5-4-8-15-32(37,38)33(39,40)34(41,42)35(43,44)45/h12-13,20,22,26-29,47-48H,4-11,14-19,21H2,1-3H3 |
| InChIKey | SCEPFHDPBMEULW-UHFFFAOYSA-N |
| XLogP | 10.08 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 705.76 |
| LogP ≤ 5 | 10.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|