C33H49F6N — CID 91331684
8,8,9,9,9-pentafluoro-N-[5-[(7R,8S,9S,11S,13S,14S)-11-fluoro-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-7-yl]pentyl]-N-methylnonan-1-amine (PubChem CID 91331684) has the molecular formula C33H49F6N and a molecular weight of 573.75 g/mol. Its IUPAC name is 8,8,9,9,9-pentafluoro-N-[5-[(7R,8S,9S,11S,13S,14S)-11-fluoro-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-7-yl]pentyl]-N-methylnonan-1-amine.
| Compound Name | 8,8,9,9,9-pentafluoro-N-[5-[(7R,8S,9S,11S,13S,14S)-11-fluoro-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-7-yl]pentyl]-N-methylnonan-1-amine |
|---|---|
| PubChem CID | 91331684 |
| Molecular Formula | C33H49F6N |
| Molecular Weight | 573.75 g/mol |
| Exact Mass | 573.38 |
| IUPAC Name | 8,8,9,9,9-pentafluoro-N-[5-[(7R,8S,9S,11S,13S,14S)-11-fluoro-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-7-yl]pentyl]-N-methylnonan-1-amine |
| SMILES | CN(CCCCCCCC(F)(F)C(F)(F)F)CCCCC[C@@H]1Cc2ccccc2[C@@H]2[C@@H]1[C@@H]1CCC[C@@]1(C)C[C@@H]2F |
| InChI | InChI=1S/C33H49F6N/c1-31-18-13-17-27(31)29-25(22-24-14-8-9-16-26(24)30(29)28(34)23-31)15-7-6-12-21-40(2)20-11-5-3-4-10-19-32(35,36)33(37,38)39/h8-9,14,16,25,27-30H,3-7,10-13,15,17-23H2,1-2H3/t25-,27+,28+,29+,30+,31+/m1/s1 |
| InChIKey | FYNGZFYFQFKEPP-KNSFHFJMSA-N |
| XLogP | 10.14 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.75 |
| LogP ≤ 5 | 10.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|