C33H49F5O2S — CID 174052297
(7R,8R,9S,13S,14S,17S)-17-methoxy-13-methyl-7-[9-(4,4,5,5,5-pentafluoropentylsulfinyl)nonyl]-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene (PubChem CID 174052297) has the molecular formula C33H49F5O2S and a molecular weight of 604.81 g/mol. Its IUPAC name is (7R,8R,9S,13S,14S,17S)-17-methoxy-13-methyl-7-[9-(4,4,5,5,5-pentafluoropentylsulfinyl)nonyl]-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene.
| Compound Name | (7R,8R,9S,13S,14S,17S)-17-methoxy-13-methyl-7-[9-(4,4,5,5,5-pentafluoropentylsulfinyl)nonyl]-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene |
|---|---|
| PubChem CID | 174052297 |
| Molecular Formula | C33H49F5O2S |
| Molecular Weight | 604.81 g/mol |
| Exact Mass | 604.34 |
| IUPAC Name | (7R,8R,9S,13S,14S,17S)-17-methoxy-13-methyl-7-[9-(4,4,5,5,5-pentafluoropentylsulfinyl)nonyl]-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene |
| SMILES | CO[C@H]1CC[C@H]2[C@@H]3[C@H](CCCCCCCCCS(=O)CCCC(F)(F)C(F)(F)F)Cc4ccccc4[C@H]3CC[C@]12C |
| InChI | InChI=1S/C33H49F5O2S/c1-31-20-18-27-26-15-10-9-13-24(26)23-25(30(27)28(31)16-17-29(31)40-2)14-8-6-4-3-5-7-11-21-41(39)22-12-19-32(34,35)33(36,37)38/h9-10,13,15,25,27-30H,3-8,11-12,14,16-23H2,1-2H3/t25-,27-,28+,29+,30-,31+,41?/m1/s1 |
| InChIKey | CPINJTMICSINQW-QYIMBGMUSA-N |
| XLogP | 9.63 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.81 |
| LogP ≤ 5 | 9.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|