C32H46F6O5S2 — CID 138701702
(7R,9S,13R,14S)-3-fluorosulfonyloxy-17-hydroxy-13-methyl-7-[9-(4,4,5,5,5-pentafluoropentylsulfinyl)nonyl]-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene (PubChem CID 138701702) has the molecular formula C32H46F6O5S2 and a molecular weight of 688.84 g/mol. Its IUPAC name is (7R,9S,13R,14S)-3-fluorosulfonyloxy-17-hydroxy-13-methyl-7-[9-(4,4,5,5,5-pentafluoropentylsulfinyl)nonyl]-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene.
| Compound Name | (7R,9S,13R,14S)-3-fluorosulfonyloxy-17-hydroxy-13-methyl-7-[9-(4,4,5,5,5-pentafluoropentylsulfinyl)nonyl]-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene |
|---|---|
| PubChem CID | 138701702 |
| Molecular Formula | C32H46F6O5S2 |
| Molecular Weight | 688.84 g/mol |
| Exact Mass | 688.27 |
| IUPAC Name | (7R,9S,13R,14S)-3-fluorosulfonyloxy-17-hydroxy-13-methyl-7-[9-(4,4,5,5,5-pentafluoropentylsulfinyl)nonyl]-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene |
| SMILES | C[C@@]12CC[C@@H]3c4ccc(OS(=O)(=O)F)cc4CC(CCCCCCCCCS(=O)CCCC(F)(F)C(F)(F)F)C3[C@@H]1CCC2O |
| InChI | InChI=1S/C32H46F6O5S2/c1-30-17-15-26-25-12-11-24(43-45(38,41)42)21-23(25)20-22(29(26)27(30)13-14-28(30)39)10-7-5-3-2-4-6-8-18-44(40)19-9-16-31(33,34)32(35,36)37/h11-12,21-22,26-29,39H,2-10,13-20H2,1H3/t22?,26-,27+,28?,29?,30-,44?/m1/s1 |
| InChIKey | UMVYXYVBFKDWGZ-UNJXKSFTSA-N |
| XLogP | 8.57 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 688.84 |
| LogP ≤ 5 | 8.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|