C32H47F5NaO6S2 — CID 131878993
CID 131878993 (PubChem CID 131878993) has the molecular formula C32H47F5NaO6S2 and a molecular weight of 709.84 g/mol.
| Compound Name | CID 131878993 |
|---|---|
| PubChem CID | 131878993 |
| Molecular Formula | C32H47F5NaO6S2 |
| Molecular Weight | 709.84 g/mol |
| Exact Mass | 709.26 |
| IUPAC Name | — |
| SMILES | C[C@]12CC[C@@H]3c4ccc(OS(=O)(=O)O)cc4C[C@@H](CCCCCCCCCS(=O)CCCC(F)(F)C(F)(F)F)[C@H]3[C@@H]1CC[C@@H]2O.[Na] |
| InChI | InChI=1S/C32H47F5O6S2.Na/c1-30-17-15-26-25-12-11-24(43-45(40,41)42)21-23(25)20-22(29(26)27(30)13-14-28(30)38)10-7-5-3-2-4-6-8-18-44(39)19-9-16-31(33,34)32(35,36)37;/h11-12,21-22,26-29,38H,2-10,13-20H2,1H3,(H,40,41,42);/t22-,26-,27+,28+,29-,30+,44?;/m1./s1 |
| InChIKey | XAZGTKQNSJDWMW-QPCOUQCRSA-N |
| XLogP | 7.78 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 709.84 |
| LogP ≤ 5 | 7.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|