C42H63F5N2O4S — CID 170160017
[17-hydroxy-13-methyl-7-[9-(4,4,5,5,5-pentafluoropentylsulfinyl)nonyl]-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-yl] 4-pyrrolidin-1-ylpiperidine-1-carboxylate (PubChem CID 170160017) has the molecular formula C42H63F5N2O4S and a molecular weight of 787.03 g/mol. Its IUPAC name is [17-hydroxy-13-methyl-7-[9-(4,4,5,5,5-pentafluoropentylsulfinyl)nonyl]-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-yl] 4-pyrrolidin-1-ylpiperidine-1-carboxylate.
| Compound Name | [17-hydroxy-13-methyl-7-[9-(4,4,5,5,5-pentafluoropentylsulfinyl)nonyl]-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-yl] 4-pyrrolidin-1-ylpiperidine-1-carboxylate |
|---|---|
| PubChem CID | 170160017 |
| Molecular Formula | C42H63F5N2O4S |
| Molecular Weight | 787.03 g/mol |
| Exact Mass | 786.44 |
| IUPAC Name | [17-hydroxy-13-methyl-7-[9-(4,4,5,5,5-pentafluoropentylsulfinyl)nonyl]-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-yl] 4-pyrrolidin-1-ylpiperidine-1-carboxylate |
| SMILES | CC12CCC3c4ccc(OC(=O)N5CCC(N6CCCC6)CC5)cc4CC(CCCCCCCCCS(=O)CCCC(F)(F)C(F)(F)F)C3C1CCC2O |
| InChI | InChI=1S/C42H63F5N2O4S/c1-40-21-17-35-34-14-13-33(53-39(51)49-24-18-32(19-25-49)48-22-8-9-23-48)29-31(34)28-30(38(35)36(40)15-16-37(40)50)12-7-5-3-2-4-6-10-26-54(52)27-11-20-41(43,44)42(45,46)47/h13-14,29-30,32,35-38,50H,2-12,15-28H2,1H3 |
| InChIKey | OMKYQAHSFPXXHW-UHFFFAOYSA-N |
| XLogP | 10.04 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 787.03 |
| LogP ≤ 5 | 10.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|