C34H48F5KO3S — CID 164724916
potassium [(7R,8R,9S,13S,14S,17S)-13-methyl-7-[9-(4,4,5,5,5-pentafluoropentylsulfinyl)nonyl]-6,7,8,9,11,12,14,15,16,17-decahydro-3H-cyclopenta[a]phenanthren-3-id-17-yl] acetate (PubChem CID 164724916) has the molecular formula C34H48F5KO3S and a molecular weight of 670.91 g/mol. Its IUPAC name is potassium [(7R,8R,9S,13S,14S,17S)-13-methyl-7-[9-(4,4,5,5,5-pentafluoropentylsulfinyl)nonyl]-6,7,8,9,11,12,14,15,16,17-decahydro-3H-cyclopenta[a]phenanthren-3-id-17-yl] acetate.
| Compound Name | potassium [(7R,8R,9S,13S,14S,17S)-13-methyl-7-[9-(4,4,5,5,5-pentafluoropentylsulfinyl)nonyl]-6,7,8,9,11,12,14,15,16,17-decahydro-3H-cyclopenta[a]phenanthren-3-id-17-yl] acetate |
|---|---|
| PubChem CID | 164724916 |
| Molecular Formula | C34H48F5KO3S |
| Molecular Weight | 670.91 g/mol |
| Exact Mass | 670.29 |
| IUPAC Name | potassium [(7R,8R,9S,13S,14S,17S)-13-methyl-7-[9-(4,4,5,5,5-pentafluoropentylsulfinyl)nonyl]-6,7,8,9,11,12,14,15,16,17-decahydro-3H-cyclopenta[a]phenanthren-3-id-17-yl] acetate |
| SMILES | CC(=O)O[C@H]1CC[C@H]2[C@@H]3[C@H](CCCCCCCCCS(=O)CCCC(F)(F)C(F)(F)F)Cc4c[c-]ccc4[C@H]3CC[C@]12C.[K+] |
| InChI | InChI=1S/C34H48F5O3S.K/c1-24(40)42-30-17-16-29-31-26(23-25-13-9-10-15-27(25)28(31)18-20-32(29,30)2)14-8-6-4-3-5-7-11-21-43(41)22-12-19-33(35,36)34(37,38)39;/h10,13,15,26,28-31H,3-8,11-12,14,16-23H2,1-2H3;/q-1;+1/t26-,28-,29+,30+,31-,32+,43?;/m1./s1 |
| InChIKey | YDJURTYSKUEWJB-TZAJPKTLSA-N |
| XLogP | 6.35 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.91 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|