C34H51F5O3S — CID 143178611
[(7R,13S,17S)-3-hydroxy-13-methyl-7-nonyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl] acetate;4,4,5,5,5-pentafluoropentane-1-thiol (PubChem CID 143178611) has the molecular formula C34H51F5O3S and a molecular weight of 634.84 g/mol. Its IUPAC name is [(7R,13S,17S)-3-hydroxy-13-methyl-7-nonyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl] acetate;4,4,5,5,5-pentafluoropentane-1-thiol.
| Compound Name | [(7R,13S,17S)-3-hydroxy-13-methyl-7-nonyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl] acetate;4,4,5,5,5-pentafluoropentane-1-thiol |
|---|---|
| PubChem CID | 143178611 |
| Molecular Formula | C34H51F5O3S |
| Molecular Weight | 634.84 g/mol |
| Exact Mass | 634.35 |
| IUPAC Name | [(7R,13S,17S)-3-hydroxy-13-methyl-7-nonyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl] acetate;4,4,5,5,5-pentafluoropentane-1-thiol |
| SMILES | CCCCCCCCCC1Cc2cc(O)ccc2C2CC[C@@]3(C)C(CC[C@@H]3OC(C)=O)C12.FC(F)(F)C(F)(F)CCCS |
| InChI | InChI=1S/C29H44O3.C5H7F5S/c1-4-5-6-7-8-9-10-11-21-18-22-19-23(31)12-13-24(22)25-16-17-29(3)26(28(21)25)14-15-27(29)32-20(2)30;6-4(7,2-1-3-11)5(8,9)10/h12-13,19,21,25-28,31H,4-11,14-18H2,1-3H3;11H,1-3H2/t21?,25?,26?,27-,28?,29-;/m0./s1 |
| InChIKey | XXCZWGFWKDNXQZ-FUBKWUDYSA-N |
| XLogP | 10.44 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.84 |
| LogP ≤ 5 | 10.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|