C34H49F5O3S — CID 89029731
[(7R,13S,17S)-3-hydroxy-13-methyl-7-[9-(1,1,1,2,2-pentafluoropentan-3-ylsulfanyl)nonyl]-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl] acetate (PubChem CID 89029731) has the molecular formula C34H49F5O3S and a molecular weight of 632.82 g/mol. Its IUPAC name is [(7R,13S,17S)-3-hydroxy-13-methyl-7-[9-(1,1,1,2,2-pentafluoropentan-3-ylsulfanyl)nonyl]-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl] acetate.
| Compound Name | [(7R,13S,17S)-3-hydroxy-13-methyl-7-[9-(1,1,1,2,2-pentafluoropentan-3-ylsulfanyl)nonyl]-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl] acetate |
|---|---|
| PubChem CID | 89029731 |
| Molecular Formula | C34H49F5O3S |
| Molecular Weight | 632.82 g/mol |
| Exact Mass | 632.33 |
| IUPAC Name | [(7R,13S,17S)-3-hydroxy-13-methyl-7-[9-(1,1,1,2,2-pentafluoropentan-3-ylsulfanyl)nonyl]-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl] acetate |
| SMILES | CCC(SCCCCCCCCCC1Cc2cc(O)ccc2C2CC[C@@]3(C)C(CC[C@@H]3OC(C)=O)C12)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C34H49F5O3S/c1-4-30(33(35,36)34(37,38)39)43-19-11-9-7-5-6-8-10-12-23-20-24-21-25(41)13-14-26(24)27-17-18-32(3)28(31(23)27)15-16-29(32)42-22(2)40/h13-14,21,23,27-31,41H,4-12,15-20H2,1-3H3/t23?,27?,28?,29-,30?,31?,32-/m0/s1 |
| InChIKey | BKNMKMMXDLSUDP-WVPNWALISA-N |
| XLogP | 10.24 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.82 |
| LogP ≤ 5 | 10.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|