C21H29NO3 — CID 166888729
[(7R,13S,17S)-7-ethyl-3-hydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl] carbamate (PubChem CID 166888729) has the molecular formula C21H29NO3 and a molecular weight of 343.47 g/mol. Its IUPAC name is [(7R,13S,17S)-7-ethyl-3-hydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl] carbamate.
| Compound Name | [(7R,13S,17S)-7-ethyl-3-hydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl] carbamate |
|---|---|
| PubChem CID | 166888729 |
| Molecular Formula | C21H29NO3 |
| Molecular Weight | 343.47 g/mol |
| Exact Mass | 343.21 |
| IUPAC Name | [(7R,13S,17S)-7-ethyl-3-hydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl] carbamate |
| SMILES | CCC1Cc2cc(O)ccc2C2CC[C@@]3(C)C(CC[C@@H]3OC(N)=O)C12 |
| InChI | InChI=1S/C21H29NO3/c1-3-12-10-13-11-14(23)4-5-15(13)16-8-9-21(2)17(19(12)16)6-7-18(21)25-20(22)24/h4-5,11-12,16-19,23H,3,6-10H2,1-2H3,(H2,22,24)/t12?,16?,17?,18-,19?,21-/m0/s1 |
| InChIKey | RALODXPMGCHBTM-YNESOWFDSA-N |
| XLogP | 4.35 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.47 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |