C25H37NO3 — CID 168849614
[(7S,13S,17S)-3-hydroxy-7,13-dimethyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl] N-pentylcarbamate (PubChem CID 168849614) has the molecular formula C25H37NO3 and a molecular weight of 399.58 g/mol. Its IUPAC name is [(7S,13S,17S)-3-hydroxy-7,13-dimethyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl] N-pentylcarbamate.
| Compound Name | [(7S,13S,17S)-3-hydroxy-7,13-dimethyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl] N-pentylcarbamate |
|---|---|
| PubChem CID | 168849614 |
| Molecular Formula | C25H37NO3 |
| Molecular Weight | 399.58 g/mol |
| Exact Mass | 399.28 |
| IUPAC Name | [(7S,13S,17S)-3-hydroxy-7,13-dimethyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl] N-pentylcarbamate |
| SMILES | CCCCCNC(=O)O[C@H]1CCC2C3C(C)Cc4cc(O)ccc4C3CC[C@@]21C |
| InChI | InChI=1S/C25H37NO3/c1-4-5-6-13-26-24(28)29-22-10-9-21-23-16(2)14-17-15-18(27)7-8-19(17)20(23)11-12-25(21,22)3/h7-8,15-16,20-23,27H,4-6,9-14H2,1-3H3,(H,26,28)/t16?,20?,21?,22-,23?,25-/m0/s1 |
| InChIKey | GZVPHQJZYDYFSM-ITMIPURLSA-N |
| XLogP | 5.78 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.58 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|