C33H53NO3 — CID 70447182
N-[9-[(7R,13S,17S)-3,17-dihydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-7-yl]nonyl]hexanamide (PubChem CID 70447182) has the molecular formula C33H53NO3 and a molecular weight of 511.79 g/mol. Its IUPAC name is N-[9-[(7R,13S,17S)-3,17-dihydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-7-yl]nonyl]hexanamide.
| Compound Name | N-[9-[(7R,13S,17S)-3,17-dihydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-7-yl]nonyl]hexanamide |
|---|---|
| PubChem CID | 70447182 |
| Molecular Formula | C33H53NO3 |
| Molecular Weight | 511.79 g/mol |
| Exact Mass | 511.40 |
| IUPAC Name | N-[9-[(7R,13S,17S)-3,17-dihydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-7-yl]nonyl]hexanamide |
| SMILES | CCCCCC(=O)NCCCCCCCCCC1Cc2cc(O)ccc2C2CC[C@@]3(C)C(CC[C@@H]3O)C12 |
| InChI | InChI=1S/C33H53NO3/c1-3-4-10-14-31(37)34-21-12-9-7-5-6-8-11-13-24-22-25-23-26(35)15-16-27(25)28-19-20-33(2)29(32(24)28)17-18-30(33)36/h15-16,23-24,28-30,32,35-36H,3-14,17-22H2,1-2H3,(H,34,37)/t24?,28?,29?,30-,32?,33-/m0/s1 |
| InChIKey | DWGDRAWZWMKGOY-NZUQVLCESA-N |
| XLogP | 7.65 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.79 |
| LogP ≤ 5 | 7.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|