C21H28O2 — CID 10662947
(7R,8R,9S,13S,14S,17S)-13-methyl-7-prop-2-enyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3,17-diol (PubChem CID 10662947) has the molecular formula C21H28O2 and a molecular weight of 312.45 g/mol. Its IUPAC name is (7R,8R,9S,13S,14S,17S)-13-methyl-7-prop-2-enyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3,17-diol.
| Compound Name | (7R,8R,9S,13S,14S,17S)-13-methyl-7-prop-2-enyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3,17-diol |
|---|---|
| PubChem CID | 10662947 |
| Molecular Formula | C21H28O2 |
| Molecular Weight | 312.45 g/mol |
| Exact Mass | 312.21 |
| IUPAC Name | (7R,8R,9S,13S,14S,17S)-13-methyl-7-prop-2-enyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3,17-diol |
| SMILES | C=CC[C@@H]1Cc2cc(O)ccc2[C@H]2CC[C@]3(C)[C@@H](O)CC[C@H]3[C@H]12 |
| InChI | InChI=1S/C21H28O2/c1-3-4-13-11-14-12-15(22)5-6-16(14)17-9-10-21(2)18(20(13)17)7-8-19(21)23/h3,5-6,12-13,17-20,22-23H,1,4,7-11H2,2H3/t13-,17-,18+,19+,20-,21+/m1/s1 |
| InChIKey | ZVXOZHUWYBXXGO-VWMZNVFKSA-N |
| XLogP | 4.41 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.45 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|