C25H30O2S — CID 67897740
(7R,8R,9S,13S,14S,17S)-13-methyl-7-(4-methylsulfanylphenyl)-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3,17-diol (PubChem CID 67897740) has the molecular formula C25H30O2S and a molecular weight of 394.58 g/mol. Its IUPAC name is (7R,8R,9S,13S,14S,17S)-13-methyl-7-(4-methylsulfanylphenyl)-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3,17-diol.
| Compound Name | (7R,8R,9S,13S,14S,17S)-13-methyl-7-(4-methylsulfanylphenyl)-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3,17-diol |
|---|---|
| PubChem CID | 67897740 |
| Molecular Formula | C25H30O2S |
| Molecular Weight | 394.58 g/mol |
| Exact Mass | 394.20 |
| IUPAC Name | (7R,8R,9S,13S,14S,17S)-13-methyl-7-(4-methylsulfanylphenyl)-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3,17-diol |
| SMILES | CSc1ccc([C@@H]2Cc3cc(O)ccc3[C@H]3CC[C@]4(C)[C@@H](O)CC[C@H]4[C@@H]32)cc1 |
| InChI | InChI=1S/C25H30O2S/c1-25-12-11-20-19-8-5-17(26)13-16(19)14-21(15-3-6-18(28-2)7-4-15)24(20)22(25)9-10-23(25)27/h3-8,13,20-24,26-27H,9-12,14H2,1-2H3/t20-,21+,22+,23+,24+,25+/m1/s1 |
| InChIKey | QNIDIDVKTPWERB-RFXJPFPRSA-N |
| XLogP | 5.72 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.58 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |