C29H45NO2S — CID 89029768
9-[(7R,13S,17S)-3,17-dihydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-7-yl]nonyl ethanimidothioate (PubChem CID 89029768) has the molecular formula C29H45NO2S and a molecular weight of 471.75 g/mol. Its IUPAC name is 9-[(7R,13S,17S)-3,17-dihydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-7-yl]nonyl ethanimidothioate.
| Compound Name | 9-[(7R,13S,17S)-3,17-dihydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-7-yl]nonyl ethanimidothioate |
|---|---|
| PubChem CID | 89029768 |
| Molecular Formula | C29H45NO2S |
| Molecular Weight | 471.75 g/mol |
| Exact Mass | 471.32 |
| IUPAC Name | 9-[(7R,13S,17S)-3,17-dihydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-7-yl]nonyl ethanimidothioate |
| SMILES | [H]/N=C(\C)SCCCCCCCCCC1Cc2cc(O)ccc2C2CC[C@@]3(C)C(CC[C@@H]3O)C12 |
| InChI | InChI=1S/C29H45NO2S/c1-20(30)33-17-9-7-5-3-4-6-8-10-21-18-22-19-23(31)11-12-24(22)25-15-16-29(2)26(28(21)25)13-14-27(29)32/h11-12,19,21,25-28,30-32H,3-10,13-18H2,1-2H3/b30-20+/t21?,25?,26?,27-,28?,29-/m0/s1 |
| InChIKey | FLWCWOQJEYTMJQ-WYWCIOEQSA-N |
| XLogP | 7.69 |
| TPSA | 64.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.75 |
| LogP ≤ 5 | 7.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|