C38H56O7 — CID 146358380
(7R,8R,9S,13S,14S,17S)-13-methyl-7-[4-[2-[2-[2-(3-phenylmethoxypropoxy)ethoxy]ethoxy]ethoxy]butyl]-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3,17-diol (PubChem CID 146358380) has the molecular formula C38H56O7 and a molecular weight of 624.86 g/mol. Its IUPAC name is (7R,8R,9S,13S,14S,17S)-13-methyl-7-[4-[2-[2-[2-(3-phenylmethoxypropoxy)ethoxy]ethoxy]ethoxy]butyl]-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3,17-diol.
| Compound Name | (7R,8R,9S,13S,14S,17S)-13-methyl-7-[4-[2-[2-[2-(3-phenylmethoxypropoxy)ethoxy]ethoxy]ethoxy]butyl]-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3,17-diol |
|---|---|
| PubChem CID | 146358380 |
| Molecular Formula | C38H56O7 |
| Molecular Weight | 624.86 g/mol |
| Exact Mass | 624.40 |
| IUPAC Name | (7R,8R,9S,13S,14S,17S)-13-methyl-7-[4-[2-[2-[2-(3-phenylmethoxypropoxy)ethoxy]ethoxy]ethoxy]butyl]-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3,17-diol |
| SMILES | C[C@]12CC[C@@H]3c4ccc(O)cc4C[C@@H](CCCCOCCOCCOCCOCCCOCc4ccccc4)[C@H]3[C@@H]1CC[C@@H]2O |
| InChI | InChI=1S/C38H56O7/c1-38-16-15-34-33-12-11-32(39)27-31(33)26-30(37(34)35(38)13-14-36(38)40)10-5-6-17-41-20-22-43-24-25-44-23-21-42-18-7-19-45-28-29-8-3-2-4-9-29/h2-4,8-9,11-12,27,30,34-37,39-40H,5-7,10,13-26,28H2,1H3/t30-,34-,35+,36+,37-,38+/m1/s1 |
| InChIKey | HOKNQPHGJOSRLJ-OAIRKJHNSA-N |
| XLogP | 6.68 |
| TPSA | 86.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.86 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|