C28H42O7 — CID 138612080
2-[2-[2-[4-[(7R,8R,13S,14S,17S)-3,17-dihydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-7-yl]butoxy]ethoxy]ethoxy]acetic acid (PubChem CID 138612080) has the molecular formula C28H42O7 and a molecular weight of 490.64 g/mol. Its IUPAC name is 2-[2-[2-[4-[(7R,8R,13S,14S,17S)-3,17-dihydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-7-yl]butoxy]ethoxy]ethoxy]acetic acid.
| Compound Name | 2-[2-[2-[4-[(7R,8R,13S,14S,17S)-3,17-dihydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-7-yl]butoxy]ethoxy]ethoxy]acetic acid |
|---|---|
| PubChem CID | 138612080 |
| Molecular Formula | C28H42O7 |
| Molecular Weight | 490.64 g/mol |
| Exact Mass | 490.29 |
| IUPAC Name | 2-[2-[2-[4-[(7R,8R,13S,14S,17S)-3,17-dihydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-7-yl]butoxy]ethoxy]ethoxy]acetic acid |
| SMILES | C[C@]12CCC3c4ccc(O)cc4C[C@@H](CCCCOCCOCCOCC(=O)O)[C@H]3[C@@H]1CC[C@@H]2O |
| InChI | InChI=1S/C28H42O7/c1-28-10-9-23-22-6-5-21(29)17-20(22)16-19(27(23)24(28)7-8-25(28)30)4-2-3-11-33-12-13-34-14-15-35-18-26(31)32/h5-6,17,19,23-25,27,29-30H,2-4,7-16,18H2,1H3,(H,31,32)/t19-,23?,24+,25+,27-,28+/m1/s1 |
| InChIKey | RNOAFJGBSMEMPZ-VDATXNRUSA-N |
| XLogP | 4.14 |
| TPSA | 105.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.64 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|