C34H56O2 — CID 25009045
(7R,13S,17S)-13-methyl-7-[(4R,8R)-4,8,12-trimethyltridecyl]-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3,17-diol (PubChem CID 25009045) has the molecular formula C34H56O2 and a molecular weight of 496.80 g/mol. Its IUPAC name is (7R,13S,17S)-13-methyl-7-[(4R,8R)-4,8,12-trimethyltridecyl]-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3,17-diol.
| Compound Name | (7R,13S,17S)-13-methyl-7-[(4R,8R)-4,8,12-trimethyltridecyl]-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3,17-diol |
|---|---|
| PubChem CID | 25009045 |
| Molecular Formula | C34H56O2 |
| Molecular Weight | 496.80 g/mol |
| Exact Mass | 496.43 |
| IUPAC Name | (7R,13S,17S)-13-methyl-7-[(4R,8R)-4,8,12-trimethyltridecyl]-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3,17-diol |
| SMILES | C[C@@H](CCC[C@@H]1CC2=C(C=CC(=C2)O)C3C1C4CC[C@@H]([C@]4(CC3)C)O)CCC[C@H](C)CCCC(C)C |
| InChI | InChI=1S/C34H56O2/c1-23(2)9-6-10-24(3)11-7-12-25(4)13-8-14-26-21-27-22-28(35)15-16-29(27)30-19-20-34(5)31(33(26)30)17-18-32(34)36/h15-16,22-26,30-33,35-36H,6-14,17-21H2,1-5H3/t24-,25-,26-,30?,31?,32+,33?,34+/m1/s1 |
| InChIKey | KGBNWZKPVRGBBX-KFGGLNDXSA-N |
| XLogP | 11.50 |
| TPSA | 40.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | 660 |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.80 |
| LogP ≤ 5 | 11.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |