C29H46N2O2 — CID 177015225
13-methyl-7-[3-[[3-[2-(methylamino)propyl]cyclobutyl]amino]propyl]-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3,17-diol (PubChem CID 177015225) has the molecular formula C29H46N2O2 and a molecular weight of 454.70 g/mol. Its IUPAC name is 13-methyl-7-[3-[[3-[2-(methylamino)propyl]cyclobutyl]amino]propyl]-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3,17-diol.
| Compound Name | 13-methyl-7-[3-[[3-[2-(methylamino)propyl]cyclobutyl]amino]propyl]-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3,17-diol |
|---|---|
| PubChem CID | 177015225 |
| Molecular Formula | C29H46N2O2 |
| Molecular Weight | 454.70 g/mol |
| Exact Mass | 454.36 |
| IUPAC Name | 13-methyl-7-[3-[[3-[2-(methylamino)propyl]cyclobutyl]amino]propyl]-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3,17-diol |
| SMILES | CNC(C)CC1CC(NCCCC2Cc3cc(O)ccc3C3CCC4(C)C(O)CCC4C23)C1 |
| InChI | InChI=1S/C29H46N2O2/c1-18(30-3)13-19-14-22(15-19)31-12-4-5-20-16-21-17-23(32)6-7-24(21)25-10-11-29(2)26(28(20)25)8-9-27(29)33/h6-7,17-20,22,25-28,30-33H,4-5,8-16H2,1-3H3 |
| InChIKey | XBIFRKQRRAAPME-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 64.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.70 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|